C14H24N5O3+ — CID 73327309
8-(2-hydroxypropylamino)-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione (PubChem CID 73327309) has the molecular formula C14H24N5O3+ and a molecular weight of 310.38 g/mol. Its IUPAC name is 8-(2-hydroxypropylamino)-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(2-hydroxypropylamino)-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73327309 |
| Molecular Formula | C14H24N5O3+ |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 8-(2-hydroxypropylamino)-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(C)C[N+]1=C(NCC(C)O)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C14H23N5O3/c1-8(2)7-19-10-11(16-13(19)15-6-9(3)20)17(4)14(22)18(5)12(10)21/h8-10,20H,6-7H2,1-5H3/p+1 |
| InChIKey | QQSBWGBVTHMRLK-UHFFFAOYSA-O |
| XLogP | -0.71 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|