C15H26N5O3+ — CID 73276796
7-hexyl-8-(2-hydroxyethylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73276796) has the molecular formula C15H26N5O3+ and a molecular weight of 324.41 g/mol. Its IUPAC name is 7-hexyl-8-(2-hydroxyethylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-hexyl-8-(2-hydroxyethylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73276796 |
| Molecular Formula | C15H26N5O3+ |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 7-hexyl-8-(2-hydroxyethylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCCCCC[N+]1=C(NCCO)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C15H25N5O3/c1-4-5-6-7-9-20-11-12(17-14(20)16-8-10-21)18(2)15(23)19(3)13(11)22/h11,21H,4-10H2,1-3H3/p+1 |
| InChIKey | YUMFZNLIXCFNFW-UHFFFAOYSA-O |
| XLogP | -0.18 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|