C14H24N5O2+ — CID 73263291
7-ethyl-1,3-dimethyl-8-(pentylamino)-5H-purin-7-ium-2,6-dione (PubChem CID 73263291) has the molecular formula C14H24N5O2+ and a molecular weight of 294.38 g/mol. Its IUPAC name is 7-ethyl-1,3-dimethyl-8-(pentylamino)-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-ethyl-1,3-dimethyl-8-(pentylamino)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73263291 |
| Molecular Formula | C14H24N5O2+ |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 7-ethyl-1,3-dimethyl-8-(pentylamino)-5H-purin-7-ium-2,6-dione |
| SMILES | CCCCCNC1=[N+](CC)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C14H23N5O2/c1-5-7-8-9-15-13-16-11-10(19(13)6-2)12(20)18(4)14(21)17(11)3/h10H,5-9H2,1-4H3/p+1 |
| InChIKey | ZNLLMSFTHJDDDS-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|