C13H20N5O3+ — CID 73157697
1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 73157697) has the molecular formula C13H20N5O3+ and a molecular weight of 294.33 g/mol. Its IUPAC name is 1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73157697 |
| Molecular Formula | C13H20N5O3+ |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CCN2CCOCC2)N(C)C1=O |
| InChI | InChI=1S/C13H20N5O3/c1-15-11-10(12(19)16(2)13(15)20)18(9-14-11)4-3-17-5-7-21-8-6-17/h9-10H,3-8H2,1-2H3/q+1 |
| InChIKey | HXAQEEFIPAPONP-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|