C18H30N6O5 — CID 73327411
ethyl 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetate (PubChem CID 73327411) has the molecular formula C18H30N6O5 and a molecular weight of 410.48 g/mol. Its IUPAC name is ethyl 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 73327411 |
| Molecular Formula | C18H30N6O5 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | ethyl 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetate |
| SMILES | CCOCCN1C(N2CCN(CC(=O)OCC)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C18H30N6O5/c1-4-28-11-10-24-14-15(21(3)18(27)20-16(14)26)19-17(24)23-8-6-22(7-9-23)12-13(25)29-5-2/h14-15H,4-12H2,1-3H3,(H,20,26,27) |
| InChIKey | FFCGTMNDFIBEJJ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|