C17H28N6O5 — CID 73327410
methyl 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetate (PubChem CID 73327410) has the molecular formula C17H28N6O5 and a molecular weight of 396.45 g/mol. Its IUPAC name is methyl 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 73327410 |
| Molecular Formula | C17H28N6O5 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | methyl 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetate |
| SMILES | CCOCCN1C(N2CCN(CC(=O)OC)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C17H28N6O5/c1-4-28-10-9-23-13-14(20(2)17(26)19-15(13)25)18-16(23)22-7-5-21(6-8-22)11-12(24)27-3/h13-14H,4-11H2,1-3H3,(H,19,25,26) |
| InChIKey | JBEYJRDKRFBWHV-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|