C17H25N6O3+ — CID 73326777
1-(3,3-dimethyl-2-oxobutyl)-3,4,7,9-tetramethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 73326777) has the molecular formula C17H25N6O3+ and a molecular weight of 361.43 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxobutyl)-3,4,7,9-tetramethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 1-(3,3-dimethyl-2-oxobutyl)-3,4,7,9-tetramethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 73326777 |
| Molecular Formula | C17H25N6O3+ |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxobutyl)-3,4,7,9-tetramethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CC1=NN(CC(=O)C(C)(C)C)C2=[N+](C1C)C1C(=O)N(C)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C17H25N6O3/c1-9-10(2)23-12-13(20(6)16(26)21(7)14(12)25)18-15(23)22(19-9)8-11(24)17(3,4)5/h10,12H,8H2,1-7H3/q+1 |
| InChIKey | VXMQLZFMIXSLQY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 88.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|