C17H28N5O3+ — CID 73280462
8-(butylamino)-7-(3,3-dimethyl-2-oxobutyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73280462) has the molecular formula C17H28N5O3+ and a molecular weight of 350.44 g/mol. Its IUPAC name is 8-(butylamino)-7-(3,3-dimethyl-2-oxobutyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(butylamino)-7-(3,3-dimethyl-2-oxobutyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73280462 |
| Molecular Formula | C17H28N5O3+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 8-(butylamino)-7-(3,3-dimethyl-2-oxobutyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCCCNC1=[N+](CC(=O)C(C)(C)C)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C17H27N5O3/c1-7-8-9-18-15-19-13-12(14(24)21(6)16(25)20(13)5)22(15)10-11(23)17(2,3)4/h12H,7-10H2,1-6H3/p+1 |
| InChIKey | WUYLRLDHGNHBIF-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|