C11H18N4O2 — CID 72738040
8-ethyl-3-methyl-7-propyl-4,5-dihydropurine-2,6-dione (PubChem CID 72738040) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 8-ethyl-3-methyl-7-propyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-ethyl-3-methyl-7-propyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 72738040 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 8-ethyl-3-methyl-7-propyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCN1C(CC)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C11H18N4O2/c1-4-6-15-7(5-2)12-9-8(15)10(16)13-11(17)14(9)3/h8-9H,4-6H2,1-3H3,(H,13,16,17) |
| InChIKey | WQNDZNOTZLOXJE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |