C11H18N5O2+ — CID 72741053
8-amino-7-butyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 72741053) has the molecular formula C11H18N5O2+ and a molecular weight of 252.30 g/mol. Its IUPAC name is 8-amino-7-butyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-amino-7-butyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 72741053 |
| Molecular Formula | C11H18N5O2+ |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 8-amino-7-butyl-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCCC[N+]1=C(N)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C11H17N5O2/c1-4-5-6-16-7-8(13-10(16)12)14(2)11(18)15(3)9(7)17/h7,12H,4-6H2,1-3H3/p+1 |
| InChIKey | LXCRVWBCJNWQKH-UHFFFAOYSA-O |
| XLogP | -0.58 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|