C9H14N4O2 — CID 72738036
8-ethyl-3,7-dimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 72738036) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 8-ethyl-3,7-dimethyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-ethyl-3,7-dimethyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 72738036 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 8-ethyl-3,7-dimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCC1=NC2C(C(=O)NC(=O)N2C)N1C |
| InChI | InChI=1S/C9H14N4O2/c1-4-5-10-7-6(12(5)2)8(14)11-9(15)13(7)3/h6-7H,4H2,1-3H3,(H,11,14,15) |
| InChIKey | HRGHUXKPWQGBJM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |