C10H16N4O2 — CID 72738039
3,8-dimethyl-7-propyl-4,5-dihydropurine-2,6-dione (PubChem CID 72738039) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3,8-dimethyl-7-propyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3,8-dimethyl-7-propyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 72738039 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3,8-dimethyl-7-propyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCN1C(C)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C10H16N4O2/c1-4-5-14-6(2)11-8-7(14)9(15)12-10(16)13(8)3/h7-8H,4-5H2,1-3H3,(H,12,15,16) |
| InChIKey | IRNFVHJSUOGVJT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |