C16H23N6O3+ — CID 73280323
1-(3,3-dimethyl-2-oxobutyl)-3,7,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 73280323) has the molecular formula C16H23N6O3+ and a molecular weight of 347.40 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxobutyl)-3,7,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 1-(3,3-dimethyl-2-oxobutyl)-3,7,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 73280323 |
| Molecular Formula | C16H23N6O3+ |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxobutyl)-3,7,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CC1=NN(CC(=O)C(C)(C)C)C2=[N+](C1)C1C(=O)N(C)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C16H23N6O3/c1-9-7-21-11-12(19(5)15(25)20(6)13(11)24)17-14(21)22(18-9)8-10(23)16(2,3)4/h11H,7-8H2,1-6H3/q+1 |
| InChIKey | BSUDPRWIOKITRR-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 88.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|