C20H34N7O4+ — CID 74580979
8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 74580979) has the molecular formula C20H34N7O4+ and a molecular weight of 436.54 g/mol. Its IUPAC name is 8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74580979 |
| Molecular Formula | C20H34N7O4+ |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(CN3CCN(CCO)CC3)=[N+]2CCN2CCOCC2)N(C)C1=O |
| InChI | InChI=1S/C20H34N7O4/c1-22-18-17(19(29)23(2)20(22)30)27(8-7-25-10-13-31-14-11-25)16(21-18)15-26-5-3-24(4-6-26)9-12-28/h17,28H,3-15H2,1-2H3/q+1 |
| InChIKey | SELHBKQHPXQODV-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|