C21H35N6O3+ — CID 74473444
8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 74473444) has the molecular formula C21H35N6O3+ and a molecular weight of 419.55 g/mol. Its IUPAC name is 8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74473444 |
| Molecular Formula | C21H35N6O3+ |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-(2-morpholin-4-ylethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC1CC(C)CN(CC2=[N+](CCN3CCOCC3)C3C(=O)N(C)C(=O)N(C)C3=N2)C1 |
| InChI | InChI=1S/C21H35N6O3/c1-15-11-16(2)13-26(12-15)14-17-22-19-18(20(28)24(4)21(29)23(19)3)27(17)6-5-25-7-9-30-10-8-25/h15-16,18H,5-14H2,1-4H3/q+1 |
| InChIKey | YGTBTRGXEOKVTL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|