C17H27N6O4+ — CID 74443569
1-[[7-(2-methoxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide (PubChem CID 74443569) has the molecular formula C17H27N6O4+ and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-[[7-(2-methoxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[7-(2-methoxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 74443569 |
| Molecular Formula | C17H27N6O4+ |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[[7-(2-methoxyethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide |
| SMILES | COCC[N+]1=C(CN2CCC(C(N)=O)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C17H26N6O4/c1-20-15-13(16(25)21(2)17(20)26)23(8-9-27-3)12(19-15)10-22-6-4-11(5-7-22)14(18)24/h11,13H,4-10H2,1-3H3,(H-,18,24)/p+1 |
| InChIKey | WLFZLGMDUOVQRM-UHFFFAOYSA-O |
| XLogP | -1.45 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|