C16H26N5O3+ — CID 74479117
7-(2-methoxyethyl)-1,3-dimethyl-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 74479117) has the molecular formula C16H26N5O3+ and a molecular weight of 336.42 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-1,3-dimethyl-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-methoxyethyl)-1,3-dimethyl-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74479117 |
| Molecular Formula | C16H26N5O3+ |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 7-(2-methoxyethyl)-1,3-dimethyl-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | COCC[N+]1=C(CN2CCCCC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H26N5O3/c1-18-14-13(15(22)19(2)16(18)23)21(9-10-24-3)12(17-14)11-20-7-5-4-6-8-20/h13H,4-11H2,1-3H3/q+1 |
| InChIKey | UTZYSDKQXVYUJG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|