C23H40N5O2+ — CID 73283410
1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-7-nonyl-5H-purin-7-ium-2,6-dione (PubChem CID 73283410) has the molecular formula C23H40N5O2+ and a molecular weight of 418.61 g/mol. Its IUPAC name is 1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-7-nonyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-7-nonyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73283410 |
| Molecular Formula | C23H40N5O2+ |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.32 |
| IUPAC Name | 1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-7-nonyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCCCCCCCC[N+]1=C(CN2CCCCC2C)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C23H40N5O2/c1-5-6-7-8-9-10-12-16-28-19(17-27-15-13-11-14-18(27)2)24-21-20(28)22(29)26(4)23(30)25(21)3/h18,20H,5-17H2,1-4H3/q+1 |
| InChIKey | FKPWQAMNJZQNSE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|