C13H21N4O2+ — CID 71650871
1-hexyl-3,7-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 71650871) has the molecular formula C13H21N4O2+ and a molecular weight of 265.34 g/mol. Its IUPAC name is 1-hexyl-3,7-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1-hexyl-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 71650871 |
| Molecular Formula | C13H21N4O2+ |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-hexyl-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCCCCCN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C13H21N4O2/c1-4-5-6-7-8-17-12(18)10-11(14-9-15(10)2)16(3)13(17)19/h9-10H,4-8H2,1-3H3/q+1 |
| InChIKey | LGFAFSBDUYPEDH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|