C16H24N5O3+ — CID 73280405
1,3-dimethyl-7-(2-oxopropyl)-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 73280405) has the molecular formula C16H24N5O3+ and a molecular weight of 334.40 g/mol. Its IUPAC name is 1,3-dimethyl-7-(2-oxopropyl)-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(2-oxopropyl)-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73280405 |
| Molecular Formula | C16H24N5O3+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1,3-dimethyl-7-(2-oxopropyl)-8-(piperidin-1-ylmethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(=O)C[N+]1=C(CN2CCCCC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H24N5O3/c1-11(22)9-21-12(10-20-7-5-4-6-8-20)17-14-13(21)15(23)19(3)16(24)18(14)2/h13H,4-10H2,1-3H3/q+1 |
| InChIKey | JGKJQQULNSKUKI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|