C17H22F3N6O4+ — CID 75355206
1-[2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (PubChem CID 75355206) has the molecular formula C17H22F3N6O4+ and a molecular weight of 431.40 g/mol. Its IUPAC name is 1-[2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 75355206 |
| Molecular Formula | C17H22F3N6O4+ |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC(=O)N2CCC(C(=O)NCC(F)(F)F)CC2)N(C)C1=O |
| InChI | InChI=1S/C17H21F3N6O4/c1-23-13-12(15(29)24(2)16(23)30)26(9-22-13)7-11(27)25-5-3-10(4-6-25)14(28)21-8-17(18,19)20/h9-10,12H,3-8H2,1-2H3/p+1 |
| InChIKey | DPOUVHYLBGEKMS-UHFFFAOYSA-O |
| XLogP | -0.75 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|