C18H27N6O4+ — CID 74443562
1-[[1,3-dimethyl-2,6-dioxo-7-(3-oxobutan-2-yl)-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide (PubChem CID 74443562) has the molecular formula C18H27N6O4+ and a molecular weight of 391.45 g/mol. Its IUPAC name is 1-[[1,3-dimethyl-2,6-dioxo-7-(3-oxobutan-2-yl)-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[1,3-dimethyl-2,6-dioxo-7-(3-oxobutan-2-yl)-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 74443562 |
| Molecular Formula | C18H27N6O4+ |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-[[1,3-dimethyl-2,6-dioxo-7-(3-oxobutan-2-yl)-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide |
| SMILES | CC(=O)C(C)[N+]1=C(CN2CCC(C(N)=O)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H26N6O4/c1-10(11(2)25)24-13(9-23-7-5-12(6-8-23)15(19)26)20-16-14(24)17(27)22(4)18(28)21(16)3/h10,12,14H,5-9H2,1-4H3,(H-,19,26)/p+1 |
| InChIKey | MYQHKLBBPGWISV-UHFFFAOYSA-O |
| XLogP | -1.12 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|