C16H26N5O2+ — CID 73327312
1,3-dimethyl-7-(2-methylpropyl)-8-piperidin-1-ium-1-ylidene-5H-purine-2,6-dione (PubChem CID 73327312) has the molecular formula C16H26N5O2+ and a molecular weight of 320.42 g/mol. Its IUPAC name is 1,3-dimethyl-7-(2-methylpropyl)-8-piperidin-1-ium-1-ylidene-5H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(2-methylpropyl)-8-piperidin-1-ium-1-ylidene-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 73327312 |
| Molecular Formula | C16H26N5O2+ |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1,3-dimethyl-7-(2-methylpropyl)-8-piperidin-1-ium-1-ylidene-5H-purine-2,6-dione |
| SMILES | CC(C)CN1C(=[N+]2CCCCC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H26N5O2/c1-11(2)10-21-12-13(18(3)16(23)19(4)14(12)22)17-15(21)20-8-6-5-7-9-20/h11-12H,5-10H2,1-4H3/q+1 |
| InChIKey | MKFZOJQAXQBIHF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|