C16H24N4O2 — CID 44820639
8-cyclopentyl-1,3-dipropyl-5H-purine-2,6-dione (PubChem CID 44820639) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 8-cyclopentyl-1,3-dipropyl-5H-purine-2,6-dione.
| Compound Name | 8-cyclopentyl-1,3-dipropyl-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 44820639 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 8-cyclopentyl-1,3-dipropyl-5H-purine-2,6-dione |
| SMILES | CCCN1C(=O)C2N=C(C3CCCC3)N=C2N(CCC)C1=O |
| InChI | InChI=1S/C16H24N4O2/c1-3-9-19-14-12(15(21)20(10-4-2)16(19)22)17-13(18-14)11-7-5-6-8-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | PHEUJGKDPNDXOC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |