C16H23BrN4O2 — CID 91575183
8-bromo-8-cyclopentyl-1,3-dipropylpurine-2,6-dione (PubChem CID 91575183) has the molecular formula C16H23BrN4O2 and a molecular weight of 383.29 g/mol. Its IUPAC name is 8-bromo-8-cyclopentyl-1,3-dipropylpurine-2,6-dione.
| Compound Name | 8-bromo-8-cyclopentyl-1,3-dipropylpurine-2,6-dione |
|---|---|
| PubChem CID | 91575183 |
| Molecular Formula | C16H23BrN4O2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 8-bromo-8-cyclopentyl-1,3-dipropylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(n(CCC)c1=O)=NC(Br)(C1CCCC1)N=2 |
| InChI | InChI=1S/C16H23BrN4O2/c1-3-9-20-13-12(14(22)21(10-4-2)15(20)23)18-16(17,19-13)11-7-5-6-8-11/h11H,3-10H2,1-2H3 |
| InChIKey | RFNTZERPASIZCL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|