C12H16N4O2 — CID 152743146
8-cyclopentyl-1,3-dimethyl-5H-purine-2,6-dione (PubChem CID 152743146) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 8-cyclopentyl-1,3-dimethyl-5H-purine-2,6-dione.
| Compound Name | 8-cyclopentyl-1,3-dimethyl-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 152743146 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 8-cyclopentyl-1,3-dimethyl-5H-purine-2,6-dione |
| SMILES | CN1C(=O)C2N=C(C3CCCC3)N=C2N(C)C1=O |
| InChI | InChI=1S/C12H16N4O2/c1-15-10-8(11(17)16(2)12(15)18)13-9(14-10)7-5-3-4-6-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | FXUOOOTUSVDUIR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |