C14H22N4O2 — CID 153310945
8-tert-butyl-3-ethyl-1-propyl-5H-purine-2,6-dione (PubChem CID 153310945) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 8-tert-butyl-3-ethyl-1-propyl-5H-purine-2,6-dione.
| Compound Name | 8-tert-butyl-3-ethyl-1-propyl-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 153310945 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 8-tert-butyl-3-ethyl-1-propyl-5H-purine-2,6-dione |
| SMILES | CCCN1C(=O)C2N=C(C(C)(C)C)N=C2N(CC)C1=O |
| InChI | InChI=1S/C14H22N4O2/c1-6-8-18-11(19)9-10(17(7-2)13(18)20)16-12(15-9)14(3,4)5/h9H,6-8H2,1-5H3 |
| InChIKey | NRQZQIIGEVMPQD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |