C10H16N4O — CID 54462037
7-imino-8-(2-methylpropyl)-2,3-dihydroimidazo[1,2-a]pyrimidin-5-one (PubChem CID 54462037) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 7-imino-8-(2-methylpropyl)-2,3-dihydroimidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 7-imino-8-(2-methylpropyl)-2,3-dihydroimidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 54462037 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 7-imino-8-(2-methylpropyl)-2,3-dihydroimidazo[1,2-a]pyrimidin-5-one |
| SMILES | [H]/N=C1\CC(=O)N2CCN=C2N1CC(C)C |
| InChI | InChI=1S/C10H16N4O/c1-7(2)6-14-8(11)5-9(15)13-4-3-12-10(13)14/h7,11H,3-6H2,1-2H3/b11-8+ |
| InChIKey | XCGSMOUZSLUPJH-DHZHZOJOSA-N |
| XLogP | 0.52 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|