C16H24N7O4+ — CID 73282321
1-[[7-(2-amino-2-oxoethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide (PubChem CID 73282321) has the molecular formula C16H24N7O4+ and a molecular weight of 378.41 g/mol. Its IUPAC name is 1-[[7-(2-amino-2-oxoethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[7-(2-amino-2-oxoethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 73282321 |
| Molecular Formula | C16H24N7O4+ |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[[7-(2-amino-2-oxoethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperidine-4-carboxamide |
| SMILES | CN1C(=O)C2C(=NC(CN3CCC(C(N)=O)CC3)=[N+]2CC(N)=O)N(C)C1=O |
| InChI | InChI=1S/C16H23N7O4/c1-20-14-12(15(26)21(2)16(20)27)23(7-10(17)24)11(19-14)8-22-5-3-9(4-6-22)13(18)25/h9,12H,3-8H2,1-2H3,(H3-,17,18,24,25)/p+1 |
| InChIKey | SNOCKULENYERBC-UHFFFAOYSA-O |
| XLogP | -2.62 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|