C21H36N5O2+ — CID 73280264
7-heptyl-1,3-dimethyl-8-[(3-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione (PubChem CID 73280264) has the molecular formula C21H36N5O2+ and a molecular weight of 390.55 g/mol. Its IUPAC name is 7-heptyl-1,3-dimethyl-8-[(3-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-heptyl-1,3-dimethyl-8-[(3-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73280264 |
| Molecular Formula | C21H36N5O2+ |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 7-heptyl-1,3-dimethyl-8-[(3-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
| SMILES | CCCCCCC[N+]1=C(CN2CCCC(C)C2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C21H36N5O2/c1-5-6-7-8-9-13-26-17(15-25-12-10-11-16(2)14-25)22-19-18(26)20(27)24(4)21(28)23(19)3/h16,18H,5-15H2,1-4H3/q+1 |
| InChIKey | ZGOXWUYRGVZDEQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|