C14H19N6O3+ — CID 73282361
1-[(1,3-dimethyl-2,6-dioxopurin-3-ium-8-yl)methyl]piperidine-4-carboxamide (PubChem CID 73282361) has the molecular formula C14H19N6O3+ and a molecular weight of 319.35 g/mol. Its IUPAC name is 1-[(1,3-dimethyl-2,6-dioxopurin-3-ium-8-yl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(1,3-dimethyl-2,6-dioxopurin-3-ium-8-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 73282361 |
| Molecular Formula | C14H19N6O3+ |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-[(1,3-dimethyl-2,6-dioxopurin-3-ium-8-yl)methyl]piperidine-4-carboxamide |
| SMILES | CN1C(=O)C2=NC(CN3CCC(C(N)=O)CC3)=NC2=[N+](C)C1=O |
| InChI | InChI=1S/C14H18N6O3/c1-18-12-10(13(22)19(2)14(18)23)16-9(17-12)7-20-5-3-8(4-6-20)11(15)21/h8H,3-7H2,1-2H3,(H-,15,21)/p+1 |
| InChIKey | FDBIBRBWULDOBB-UHFFFAOYSA-O |
| XLogP | -1.33 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|