C13H18N5O2+ — CID 78175645
1,3-dimethyl-8-(piperidin-1-ylmethyl)purin-3-ium-2,6-dione (PubChem CID 78175645) has the molecular formula C13H18N5O2+ and a molecular weight of 276.32 g/mol. Its IUPAC name is 1,3-dimethyl-8-(piperidin-1-ylmethyl)purin-3-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(piperidin-1-ylmethyl)purin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 78175645 |
| Molecular Formula | C13H18N5O2+ |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1,3-dimethyl-8-(piperidin-1-ylmethyl)purin-3-ium-2,6-dione |
| SMILES | CN1C(=O)C2=NC(CN3CCCCC3)=NC2=[N+](C)C1=O |
| InChI | InChI=1S/C13H18N5O2/c1-16-11-10(12(19)17(2)13(16)20)14-9(15-11)8-18-6-4-3-5-7-18/h3-8H2,1-2H3/q+1 |
| InChIKey | DXNDAYLEKXWXEK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|