C13H19N4O2+ — CID 71650856
1,3-dibutylpurin-3-ium-2,6-dione (PubChem CID 71650856) has the molecular formula C13H19N4O2+ and a molecular weight of 263.32 g/mol. Its IUPAC name is 1,3-dibutylpurin-3-ium-2,6-dione.
| Compound Name | 1,3-dibutylpurin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 71650856 |
| Molecular Formula | C13H19N4O2+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1,3-dibutylpurin-3-ium-2,6-dione |
| SMILES | CCCCN1C(=O)C2=NC=NC2=[N+](CCCC)C1=O |
| InChI | InChI=1S/C13H19N4O2/c1-3-5-7-16-11-10(14-9-15-11)12(18)17(13(16)19)8-6-4-2/h9H,3-8H2,1-2H3/q+1 |
| InChIKey | LGUNPPSQVNGGSQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|