C11H14N4O2 — CID 18936627
1,8-dipropylpurine-2,6-dione (PubChem CID 18936627) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 1,8-dipropylpurine-2,6-dione.
| Compound Name | 1,8-dipropylpurine-2,6-dione |
|---|---|
| PubChem CID | 18936627 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1,8-dipropylpurine-2,6-dione |
| SMILES | CCCC1=NC2=NC(=O)N(CCC)C(=O)C2=N1 |
| InChI | InChI=1S/C11H14N4O2/c1-3-5-7-12-8-9(13-7)14-11(17)15(6-4-2)10(8)16/h3-6H2,1-2H3 |
| InChIKey | JMHXQDAKIULSKT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 74.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |