C16H25N6O3+ — CID 78204399
1-(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-8-ylidene)piperidin-1-ium-4-carboxamide (PubChem CID 78204399) has the molecular formula C16H25N6O3+ and a molecular weight of 349.42 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-8-ylidene)piperidin-1-ium-4-carboxamide.
| Compound Name | 1-(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-8-ylidene)piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 78204399 |
| Molecular Formula | C16H25N6O3+ |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-8-ylidene)piperidin-1-ium-4-carboxamide |
| SMILES | CCCN1C(=[N+]2CCC(C(N)=O)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H24N6O3/c1-4-7-22-11-13(19(2)16(25)20(3)14(11)24)18-15(22)21-8-5-10(6-9-21)12(17)23/h10-11H,4-9H2,1-3H3,(H-,17,23)/p+1 |
| InChIKey | LSROAKQLHKJHET-UHFFFAOYSA-O |
| XLogP | -0.73 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|