C18H29N6O3+ — CID 78200604
2-[3-methyl-7-(3-methylbutyl)-2,6-dioxo-8-piperidin-1-ium-1-ylidene-5H-purin-1-yl]acetamide (PubChem CID 78200604) has the molecular formula C18H29N6O3+ and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-[3-methyl-7-(3-methylbutyl)-2,6-dioxo-8-piperidin-1-ium-1-ylidene-5H-purin-1-yl]acetamide.
| Compound Name | 2-[3-methyl-7-(3-methylbutyl)-2,6-dioxo-8-piperidin-1-ium-1-ylidene-5H-purin-1-yl]acetamide |
|---|---|
| PubChem CID | 78200604 |
| Molecular Formula | C18H29N6O3+ |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 2-[3-methyl-7-(3-methylbutyl)-2,6-dioxo-8-piperidin-1-ium-1-ylidene-5H-purin-1-yl]acetamide |
| SMILES | CC(C)CCN1C(=[N+]2CCCCC2)N=C2C1C(=O)N(CC(N)=O)C(=O)N2C |
| InChI | InChI=1S/C18H28N6O3/c1-12(2)7-10-23-14-15(20-17(23)22-8-5-4-6-9-22)21(3)18(27)24(16(14)26)11-13(19)25/h12,14H,4-11H2,1-3H3,(H-,19,25)/p+1 |
| InChIKey | AURVNVQPTDYQKF-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|