C17H28N6O3 — CID 78201362
1-(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)piperidine-4-carboxamide (PubChem CID 78201362) has the molecular formula C17H28N6O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)piperidine-4-carboxamide.
| Compound Name | 1-(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78201362 |
| Molecular Formula | C17H28N6O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-(3-methyl-2,6-dioxo-7-pentyl-4,5-dihydropurin-8-yl)piperidine-4-carboxamide |
| SMILES | CCCCCN1C(N2CCC(C(N)=O)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C17H28N6O3/c1-3-4-5-8-23-12-14(21(2)17(26)20-15(12)25)19-16(23)22-9-6-11(7-10-22)13(18)24/h11-12,14H,3-10H2,1-2H3,(H2,18,24)(H,20,25,26) |
| InChIKey | AHPRAWIRRLPUIG-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|