C18H30N6O3 — CID 78201474
1-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperidine-4-carboxamide (PubChem CID 78201474) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperidine-4-carboxamide.
| Compound Name | 1-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78201474 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-(7-hexyl-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl)piperidine-4-carboxamide |
| SMILES | CCCCCCN1C(N2CCC(C(N)=O)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C18H30N6O3/c1-3-4-5-6-9-24-13-15(22(2)18(27)21-16(13)26)20-17(24)23-10-7-12(8-11-23)14(19)25/h12-13,15H,3-11H2,1-2H3,(H2,19,25)(H,21,26,27) |
| InChIKey | GYPXKSJAKNYRPF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|