C17H26N5O4+ — CID 74443564
methyl 2-[1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]acetate (PubChem CID 74443564) has the molecular formula C17H26N5O4+ and a molecular weight of 364.43 g/mol. Its IUPAC name is methyl 2-[1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]acetate.
| Compound Name | methyl 2-[1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]acetate |
|---|---|
| PubChem CID | 74443564 |
| Molecular Formula | C17H26N5O4+ |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | methyl 2-[1,3-dimethyl-8-[(4-methylpiperidin-1-yl)methyl]-2,6-dioxo-5H-purin-7-ium-7-yl]acetate |
| SMILES | COC(=O)C[N+]1=C(CN2CCC(C)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C17H26N5O4/c1-11-5-7-21(8-6-11)9-12-18-15-14(22(12)10-13(23)26-4)16(24)20(3)17(25)19(15)2/h11,14H,5-10H2,1-4H3/q+1 |
| InChIKey | AGHLZCUNGPQYJZ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|