C20H34N5O2+ — CID 74443576
8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-(3-methylbutyl)-5H-purin-7-ium-2,6-dione (PubChem CID 74443576) has the molecular formula C20H34N5O2+ and a molecular weight of 376.53 g/mol. Its IUPAC name is 8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-(3-methylbutyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-(3-methylbutyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74443576 |
| Molecular Formula | C20H34N5O2+ |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 8-[(3,5-dimethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-(3-methylbutyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(C)CC[N+]1=C(CN2CC(C)CC(C)C2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C20H34N5O2/c1-13(2)7-8-25-16(12-24-10-14(3)9-15(4)11-24)21-18-17(25)19(26)23(6)20(27)22(18)5/h13-15,17H,7-12H2,1-6H3/q+1 |
| InChIKey | DLORZGAQCQJPFO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|