C21H34N7O5+ — CID 74740373
ethyl 4-[[1,3-dimethyl-7-(2-morpholin-4-ylethyl)-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate (PubChem CID 74740373) has the molecular formula C21H34N7O5+ and a molecular weight of 464.55 g/mol. Its IUPAC name is ethyl 4-[[1,3-dimethyl-7-(2-morpholin-4-ylethyl)-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[1,3-dimethyl-7-(2-morpholin-4-ylethyl)-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 74740373 |
| Molecular Formula | C21H34N7O5+ |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | ethyl 4-[[1,3-dimethyl-7-(2-morpholin-4-ylethyl)-2,6-dioxo-5H-purin-7-ium-8-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC2=[N+](CCN3CCOCC3)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1 |
| InChI | InChI=1S/C21H34N7O5/c1-4-33-21(31)27-8-5-26(6-9-27)15-16-22-18-17(19(29)24(3)20(30)23(18)2)28(16)10-7-25-11-13-32-14-12-25/h17H,4-15H2,1-3H3/q+1 |
| InChIKey | XHQFVJSZPQOBIX-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|