About carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile
carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile (PubChem CID 159841475) has the molecular formula C12H16ClNO3Si
and a molecular weight of 285.80 g/mol. Its IUPAC name is carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile.
Molecular Properties
| Compound Name | carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile |
| PubChem CID | 159841475 |
| Molecular Formula | C12H16ClNO3Si |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile |
| SMILES | CC1=CC=C(C(C#N)O[Si](C)(C)CCl)C1.O=C=O |
| InChI | InChI=1S/C11H16ClNOSi.CO2/c1-9-4-5-10(6-9)11(7-13)14-15(2,3)8-12;2-1-3/h4-5,11H,6,8H2,1-3H3; |
| InChIKey | NOSPPKGBDQEPOY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile?
The IUPAC name of carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile (CID 159841475) is carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile.
What is the SMILES notation for carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile?
The canonical SMILES for carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile is CC1=CC=C(C(C#N)O[Si](C)(C)CCl)C1.O=C=O.
What is the InChIKey of carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile?
The InChIKey is NOSPPKGBDQEPOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClNOSi.CO2/c1-9-4-5-10(6-9)11(7-13)14-15(2,3)8-12;2-1-3/h4-5,11H,6,8H2,1-3H3;.
What are the key properties of carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile?
carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile has a molecular weight of 285.80 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile is sourced from PubChem (CID 159841475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).