C11H16ClNOSi — CID 159841476
2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile (PubChem CID 159841476) has the molecular formula C11H16ClNOSi and a molecular weight of 241.79 g/mol. Its IUPAC name is 2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile.
| Compound Name | 2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile |
|---|---|
| PubChem CID | 159841476 |
| Molecular Formula | C11H16ClNOSi |
| Molecular Weight | 241.79 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)acetonitrile |
| SMILES | CC1=CC=C(C(C#N)O[Si](C)(C)CCl)C1 |
| InChI | InChI=1S/C11H16ClNOSi/c1-9-4-5-10(6-9)11(7-13)14-15(2,3)8-12/h4-5,11H,6,8H2,1-3H3 |
| InChIKey | DSPIKDJRYGGUGZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|