C16H28ClNOSi — CID 10567208
(5E,9E)-11-chloro-5,9-dimethyl-2-trimethylsilyloxyundeca-5,9-dienenitrile (PubChem CID 10567208) has the molecular formula C16H28ClNOSi and a molecular weight of 313.95 g/mol. Its IUPAC name is (5E,9E)-11-chloro-5,9-dimethyl-2-trimethylsilyloxyundeca-5,9-dienenitrile.
| Compound Name | (5E,9E)-11-chloro-5,9-dimethyl-2-trimethylsilyloxyundeca-5,9-dienenitrile |
|---|---|
| PubChem CID | 10567208 |
| Molecular Formula | C16H28ClNOSi |
| Molecular Weight | 313.95 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (5E,9E)-11-chloro-5,9-dimethyl-2-trimethylsilyloxyundeca-5,9-dienenitrile |
| SMILES | C/C(=C\CCl)CC/C=C(\C)CCC(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C16H28ClNOSi/c1-14(7-6-8-15(2)11-12-17)9-10-16(13-18)19-20(3,4)5/h7,11,16H,6,8-10,12H2,1-5H3/b14-7+,15-11+ |
| InChIKey | BHEVGHLWLNCBSV-LRDJDILRSA-N |
| XLogP | 5.42 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|