C31H60O2Si2 — CID 23266188
trimethyl-[(4Z,8Z,12Z,16Z)-4,8,12,16-tetramethyl-20-trimethylsilyloxyhenicosa-4,8,12,16-tetraenoxy]silane (PubChem CID 23266188) has the molecular formula C31H60O2Si2 and a molecular weight of 520.99 g/mol. Its IUPAC name is trimethyl-[(4Z,8Z,12Z,16Z)-4,8,12,16-tetramethyl-20-trimethylsilyloxyhenicosa-4,8,12,16-tetraenoxy]silane.
| Compound Name | trimethyl-[(4Z,8Z,12Z,16Z)-4,8,12,16-tetramethyl-20-trimethylsilyloxyhenicosa-4,8,12,16-tetraenoxy]silane |
|---|---|
| PubChem CID | 23266188 |
| Molecular Formula | C31H60O2Si2 |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.41 |
| IUPAC Name | trimethyl-[(4Z,8Z,12Z,16Z)-4,8,12,16-tetramethyl-20-trimethylsilyloxyhenicosa-4,8,12,16-tetraenoxy]silane |
| SMILES | C/C(=C/CC/C(C)=C\CCC(C)O[Si](C)(C)C)CC/C=C(/C)CC/C=C(/C)CCCO[Si](C)(C)C |
| InChI | InChI=1S/C31H60O2Si2/c1-27(19-13-21-29(3)23-15-25-31(5)33-35(9,10)11)17-12-18-28(2)20-14-22-30(4)24-16-26-32-34(6,7)8/h18-19,22-23,31H,12-17,20-21,24-26H2,1-11H3/b27-19-,28-18-,29-23-,30-22- |
| InChIKey | YGCSUOAOLGZKPL-XNSOQYQASA-N |
| XLogP | 10.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|