C12H18ClNOSi — CID 157176273
2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)propanenitrile (PubChem CID 157176273) has the molecular formula C12H18ClNOSi and a molecular weight of 255.82 g/mol. Its IUPAC name is 2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)propanenitrile.
| Compound Name | 2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)propanenitrile |
|---|---|
| PubChem CID | 157176273 |
| Molecular Formula | C12H18ClNOSi |
| Molecular Weight | 255.82 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[chloromethyl(dimethyl)silyl]oxy-2-(4-methylcyclopenta-1,3-dien-1-yl)propanenitrile |
| SMILES | CC1=CC=C(C(C)(C#N)O[Si](C)(C)CCl)C1 |
| InChI | InChI=1S/C12H18ClNOSi/c1-10-5-6-11(7-10)12(2,8-14)15-16(3,4)9-13/h5-6H,7,9H2,1-4H3 |
| InChIKey | AOAQUKKAETYRQJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|