C15H19NOSi — CID 101254335
2,2-di(cyclopenta-1,3-dien-1-yl)-2-trimethylsilyloxyacetonitrile (PubChem CID 101254335) has the molecular formula C15H19NOSi and a molecular weight of 257.41 g/mol. Its IUPAC name is 2,2-di(cyclopenta-1,3-dien-1-yl)-2-trimethylsilyloxyacetonitrile.
| Compound Name | 2,2-di(cyclopenta-1,3-dien-1-yl)-2-trimethylsilyloxyacetonitrile |
|---|---|
| PubChem CID | 101254335 |
| Molecular Formula | C15H19NOSi |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2,2-di(cyclopenta-1,3-dien-1-yl)-2-trimethylsilyloxyacetonitrile |
| SMILES | C[Si](C)(C)OC(C#N)(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C15H19NOSi/c1-18(2,3)17-15(12-16,13-8-4-5-9-13)14-10-6-7-11-14/h4-8,10H,9,11H2,1-3H3 |
| InChIKey | JEXFKZZMVZLDMM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|