C12H19NOSi — CID 101254329
2-cyclopenta-1,3-dien-1-yl-2-trimethylsilyloxybutanenitrile (PubChem CID 101254329) has the molecular formula C12H19NOSi and a molecular weight of 221.38 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-yl-2-trimethylsilyloxybutanenitrile.
| Compound Name | 2-cyclopenta-1,3-dien-1-yl-2-trimethylsilyloxybutanenitrile |
|---|---|
| PubChem CID | 101254329 |
| Molecular Formula | C12H19NOSi |
| Molecular Weight | 221.38 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-yl-2-trimethylsilyloxybutanenitrile |
| SMILES | CCC(C#N)(O[Si](C)(C)C)C1=CC=CC1 |
| InChI | InChI=1S/C12H19NOSi/c1-5-12(10-13,14-15(2,3)4)11-8-6-7-9-11/h6-8H,5,9H2,1-4H3 |
| InChIKey | RCDLKNWTARTEMK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|