C11H17NOSi — CID 101254333
2-cyclopenta-1,3-dien-1-yl-2-trimethylsilyloxypropanenitrile (PubChem CID 101254333) has the molecular formula C11H17NOSi and a molecular weight of 207.35 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-yl-2-trimethylsilyloxypropanenitrile.
| Compound Name | 2-cyclopenta-1,3-dien-1-yl-2-trimethylsilyloxypropanenitrile |
|---|---|
| PubChem CID | 101254333 |
| Molecular Formula | C11H17NOSi |
| Molecular Weight | 207.35 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-yl-2-trimethylsilyloxypropanenitrile |
| SMILES | CC(C#N)(O[Si](C)(C)C)C1=CC=CC1 |
| InChI | InChI=1S/C11H17NOSi/c1-11(9-12,13-14(2,3)4)10-7-5-6-8-10/h5-7H,8H2,1-4H3 |
| InChIKey | XEEBCPXHEGTXJU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|