About CID 159842557
CID 159842557 (PubChem CID 159842557) has the molecular formula C35H28B2BrO5
and a molecular weight of 630.13 g/mol.
Molecular Properties
| Compound Name | CID 159842557 |
| PubChem CID | 159842557 |
| Molecular Formula | C35H28B2BrO5 |
| Molecular Weight | 630.13 g/mol |
| Exact Mass | 629.13 |
| IUPAC Name | — |
| SMILES | Brc1ccc2ccc3cccc4ccc1c2c34.COB(OC)OC.O[B]Oc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C16H10BO2.C16H9Br.C3H9BO3/c18-17-19-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;1-5-4(6-2)7-3/h1-9,18H;1-9H;1-3H3 |
| InChIKey | QXFGAOGJEKMINB-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 630.13 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 159842557 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159842557?
The IUPAC name of CID 159842557 (CID 159842557) is not available.
What is the SMILES notation for CID 159842557?
The canonical SMILES for CID 159842557 is Brc1ccc2ccc3cccc4ccc1c2c34.COB(OC)OC.O[B]Oc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of CID 159842557?
The InChIKey is QXFGAOGJEKMINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BO2.C16H9Br.C3H9BO3/c18-17-19-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;1-5-4(6-2)7-3/h1-9,18H;1-9H;1-3H3.
What are the key properties of CID 159842557?
CID 159842557 has a molecular weight of 630.13 g/mol, XLogP of 8.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159842557 is sourced from PubChem (CID 159842557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).